C18H17FN6O2 — CID 19145195
N'-[5-amino-6-(2-fluoroanilino)pyrimidin-4-yl]-4-methoxybenzohydrazide (PubChem CID 19145195) has the molecular formula C18H17FN6O2 and a molecular weight of 368.37 g/mol. Its IUPAC name is N'-[5-amino-6-(2-fluoroanilino)pyrimidin-4-yl]-4-methoxybenzohydrazide.
| Compound Name | N'-[5-amino-6-(2-fluoroanilino)pyrimidin-4-yl]-4-methoxybenzohydrazide |
|---|---|
| PubChem CID | 19145195 |
| Molecular Formula | C18H17FN6O2 |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | N'-[5-amino-6-(2-fluoroanilino)pyrimidin-4-yl]-4-methoxybenzohydrazide |
| SMILES | COc1ccc(C(=O)NNc2ncnc(Nc3ccccc3F)c2N)cc1 |
| InChI | InChI=1S/C18H17FN6O2/c1-27-12-8-6-11(7-9-12)18(26)25-24-17-15(20)16(21-10-22-17)23-14-5-3-2-4-13(14)19/h2-10H,20H2,1H3,(H,25,26)(H2,21,22,23,24) |
| InChIKey | DSJYJQZRGBBPPN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|