C19H17F3N6O2 — CID 22545649
N'-[5-amino-6-[2-(trifluoromethyl)anilino]pyrimidin-4-yl]-4-methoxybenzohydrazide (PubChem CID 22545649) has the molecular formula C19H17F3N6O2 and a molecular weight of 418.38 g/mol. Its IUPAC name is N'-[5-amino-6-[2-(trifluoromethyl)anilino]pyrimidin-4-yl]-4-methoxybenzohydrazide.
| Compound Name | N'-[5-amino-6-[2-(trifluoromethyl)anilino]pyrimidin-4-yl]-4-methoxybenzohydrazide |
|---|---|
| PubChem CID | 22545649 |
| Molecular Formula | C19H17F3N6O2 |
| Molecular Weight | 418.38 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | N'-[5-amino-6-[2-(trifluoromethyl)anilino]pyrimidin-4-yl]-4-methoxybenzohydrazide |
| SMILES | COc1ccc(C(=O)NNc2ncnc(Nc3ccccc3C(F)(F)F)c2N)cc1 |
| InChI | InChI=1S/C19H17F3N6O2/c1-30-12-8-6-11(7-9-12)18(29)28-27-17-15(23)16(24-10-25-17)26-14-5-3-2-4-13(14)19(20,21)22/h2-10H,23H2,1H3,(H,28,29)(H2,24,25,26,27) |
| InChIKey | UKDJMGLOFPCQSX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|