C18H13Cl2F3N6O — CID 22545648
N'-[5-amino-6-[2-(trifluoromethyl)anilino]pyrimidin-4-yl]-2,4-dichlorobenzohydrazide (PubChem CID 22545648) has the molecular formula C18H13Cl2F3N6O and a molecular weight of 457.24 g/mol. Its IUPAC name is N'-[5-amino-6-[2-(trifluoromethyl)anilino]pyrimidin-4-yl]-2,4-dichlorobenzohydrazide.
| Compound Name | N'-[5-amino-6-[2-(trifluoromethyl)anilino]pyrimidin-4-yl]-2,4-dichlorobenzohydrazide |
|---|---|
| PubChem CID | 22545648 |
| Molecular Formula | C18H13Cl2F3N6O |
| Molecular Weight | 457.24 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | N'-[5-amino-6-[2-(trifluoromethyl)anilino]pyrimidin-4-yl]-2,4-dichlorobenzohydrazide |
| SMILES | Nc1c(NNC(=O)c2ccc(Cl)cc2Cl)ncnc1Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H13Cl2F3N6O/c19-9-5-6-10(12(20)7-9)17(30)29-28-16-14(24)15(25-8-26-16)27-13-4-2-1-3-11(13)18(21,22)23/h1-8H,24H2,(H,29,30)(H2,25,26,27,28) |
| InChIKey | NBEJPXFNFQZHAI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.24 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|