C17H13BrCl2N6O — CID 19149808
N'-[5-amino-6-(2,4-dichloroanilino)pyrimidin-4-yl]-2-bromobenzohydrazide (PubChem CID 19149808) has the molecular formula C17H13BrCl2N6O and a molecular weight of 468.14 g/mol. Its IUPAC name is N'-[5-amino-6-(2,4-dichloroanilino)pyrimidin-4-yl]-2-bromobenzohydrazide.
| Compound Name | N'-[5-amino-6-(2,4-dichloroanilino)pyrimidin-4-yl]-2-bromobenzohydrazide |
|---|---|
| PubChem CID | 19149808 |
| Molecular Formula | C17H13BrCl2N6O |
| Molecular Weight | 468.14 g/mol |
| Exact Mass | 465.97 |
| IUPAC Name | N'-[5-amino-6-(2,4-dichloroanilino)pyrimidin-4-yl]-2-bromobenzohydrazide |
| SMILES | Nc1c(NNC(=O)c2ccccc2Br)ncnc1Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H13BrCl2N6O/c18-11-4-2-1-3-10(11)17(27)26-25-16-14(21)15(22-8-23-16)24-13-6-5-9(19)7-12(13)20/h1-8H,21H2,(H,26,27)(H2,22,23,24,25) |
| InChIKey | XORWWZAALUUXAX-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.14 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|