C17H14BrClN6O — CID 19148804
N'-[5-amino-6-(4-bromoanilino)pyrimidin-4-yl]-2-chlorobenzohydrazide (PubChem CID 19148804) has the molecular formula C17H14BrClN6O and a molecular weight of 433.70 g/mol. Its IUPAC name is N'-[5-amino-6-(4-bromoanilino)pyrimidin-4-yl]-2-chlorobenzohydrazide.
| Compound Name | N'-[5-amino-6-(4-bromoanilino)pyrimidin-4-yl]-2-chlorobenzohydrazide |
|---|---|
| PubChem CID | 19148804 |
| Molecular Formula | C17H14BrClN6O |
| Molecular Weight | 433.70 g/mol |
| Exact Mass | 432.01 |
| IUPAC Name | N'-[5-amino-6-(4-bromoanilino)pyrimidin-4-yl]-2-chlorobenzohydrazide |
| SMILES | Nc1c(NNC(=O)c2ccccc2Cl)ncnc1Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H14BrClN6O/c18-10-5-7-11(8-6-10)23-15-14(20)16(22-9-21-15)24-25-17(26)12-3-1-2-4-13(12)19/h1-9H,20H2,(H,25,26)(H2,21,22,23,24) |
| InChIKey | FKZAAXIKVKOMBJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.70 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|