C20H20Cl2N6O — CID 19134693
N'-[5-amino-6-(4-propan-2-ylanilino)pyrimidin-4-yl]-2,4-dichlorobenzohydrazide (PubChem CID 19134693) has the molecular formula C20H20Cl2N6O and a molecular weight of 431.33 g/mol. Its IUPAC name is N'-[5-amino-6-(4-propan-2-ylanilino)pyrimidin-4-yl]-2,4-dichlorobenzohydrazide.
| Compound Name | N'-[5-amino-6-(4-propan-2-ylanilino)pyrimidin-4-yl]-2,4-dichlorobenzohydrazide |
|---|---|
| PubChem CID | 19134693 |
| Molecular Formula | C20H20Cl2N6O |
| Molecular Weight | 431.33 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | N'-[5-amino-6-(4-propan-2-ylanilino)pyrimidin-4-yl]-2,4-dichlorobenzohydrazide |
| SMILES | CC(C)c1ccc(Nc2ncnc(NNC(=O)c3ccc(Cl)cc3Cl)c2N)cc1 |
| InChI | InChI=1S/C20H20Cl2N6O/c1-11(2)12-3-6-14(7-4-12)26-18-17(23)19(25-10-24-18)27-28-20(29)15-8-5-13(21)9-16(15)22/h3-11H,23H2,1-2H3,(H,28,29)(H2,24,25,26,27) |
| InChIKey | VAVMHJCSTCCKEC-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.33 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|