C25H21Cl2N7O2 — CID 19151677
N'-[5-amino-6-[2-(2,2-diphenylacetyl)hydrazinyl]pyrimidin-4-yl]-2,4-dichlorobenzohydrazide (PubChem CID 19151677) has the molecular formula C25H21Cl2N7O2 and a molecular weight of 522.40 g/mol. Its IUPAC name is N'-[5-amino-6-[2-(2,2-diphenylacetyl)hydrazinyl]pyrimidin-4-yl]-2,4-dichlorobenzohydrazide.
| Compound Name | N'-[5-amino-6-[2-(2,2-diphenylacetyl)hydrazinyl]pyrimidin-4-yl]-2,4-dichlorobenzohydrazide |
|---|---|
| PubChem CID | 19151677 |
| Molecular Formula | C25H21Cl2N7O2 |
| Molecular Weight | 522.40 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | N'-[5-amino-6-[2-(2,2-diphenylacetyl)hydrazinyl]pyrimidin-4-yl]-2,4-dichlorobenzohydrazide |
| SMILES | Nc1c(NNC(=O)c2ccc(Cl)cc2Cl)ncnc1NNC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H21Cl2N7O2/c26-17-11-12-18(19(27)13-17)24(35)33-31-22-21(28)23(30-14-29-22)32-34-25(36)20(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-14,20H,28H2,(H,33,35)(H,34,36)(H2,29,30,31,32) |
| InChIKey | WNJIQUQRBBDCSU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 134.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.40 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|