C26H24ClN5O2 — CID 19152184
N'-[5-amino-6-(4-chloro-3,5-dimethylphenoxy)pyrimidin-4-yl]-2,2-diphenylacetohydrazide (PubChem CID 19152184) has the molecular formula C26H24ClN5O2 and a molecular weight of 473.96 g/mol. Its IUPAC name is N'-[5-amino-6-(4-chloro-3,5-dimethylphenoxy)pyrimidin-4-yl]-2,2-diphenylacetohydrazide.
| Compound Name | N'-[5-amino-6-(4-chloro-3,5-dimethylphenoxy)pyrimidin-4-yl]-2,2-diphenylacetohydrazide |
|---|---|
| PubChem CID | 19152184 |
| Molecular Formula | C26H24ClN5O2 |
| Molecular Weight | 473.96 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | N'-[5-amino-6-(4-chloro-3,5-dimethylphenoxy)pyrimidin-4-yl]-2,2-diphenylacetohydrazide |
| SMILES | Cc1cc(Oc2ncnc(NNC(=O)C(c3ccccc3)c3ccccc3)c2N)cc(C)c1Cl |
| InChI | InChI=1S/C26H24ClN5O2/c1-16-13-20(14-17(2)22(16)27)34-26-23(28)24(29-15-30-26)31-32-25(33)21(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-15,21H,28H2,1-2H3,(H,32,33)(H,29,30,31) |
| InChIKey | IELDBEQBEUKAEH-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.96 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|