C18H17ClN6O2 — CID 19151839
N'-[5-amino-6-(4-chloro-3,5-dimethylphenoxy)pyrimidin-4-yl]pyridine-4-carbohydrazide (PubChem CID 19151839) has the molecular formula C18H17ClN6O2 and a molecular weight of 384.83 g/mol. Its IUPAC name is N'-[5-amino-6-(4-chloro-3,5-dimethylphenoxy)pyrimidin-4-yl]pyridine-4-carbohydrazide.
| Compound Name | N'-[5-amino-6-(4-chloro-3,5-dimethylphenoxy)pyrimidin-4-yl]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 19151839 |
| Molecular Formula | C18H17ClN6O2 |
| Molecular Weight | 384.83 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | N'-[5-amino-6-(4-chloro-3,5-dimethylphenoxy)pyrimidin-4-yl]pyridine-4-carbohydrazide |
| SMILES | Cc1cc(Oc2ncnc(NNC(=O)c3ccncc3)c2N)cc(C)c1Cl |
| InChI | InChI=1S/C18H17ClN6O2/c1-10-7-13(8-11(2)14(10)19)27-18-15(20)16(22-9-23-18)24-25-17(26)12-3-5-21-6-4-12/h3-9H,20H2,1-2H3,(H,25,26)(H,22,23,24) |
| InChIKey | LNDMZLWIQZPZBF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.83 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|