C10H12N8O — CID 19150368
N'-(5-amino-6-hydrazinylpyrimidin-4-yl)pyridine-4-carbohydrazide (PubChem CID 19150368) has the molecular formula C10H12N8O and a molecular weight of 260.26 g/mol. Its IUPAC name is N'-(5-amino-6-hydrazinylpyrimidin-4-yl)pyridine-4-carbohydrazide.
| Compound Name | N'-(5-amino-6-hydrazinylpyrimidin-4-yl)pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 19150368 |
| Molecular Formula | C10H12N8O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | N'-(5-amino-6-hydrazinylpyrimidin-4-yl)pyridine-4-carbohydrazide |
| SMILES | NNc1ncnc(NNC(=O)c2ccncc2)c1N |
| InChI | InChI=1S/C10H12N8O/c11-7-8(16-12)14-5-15-9(7)17-18-10(19)6-1-3-13-4-2-6/h1-5H,11-12H2,(H,18,19)(H2,14,15,16,17) |
| InChIKey | JBANMBDKVFIRAV-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 143.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|