C17H16N8O2 — CID 19150633
N'-[5-amino-6-(2-benzoylhydrazinyl)pyrimidin-4-yl]pyridine-3-carbohydrazide (PubChem CID 19150633) has the molecular formula C17H16N8O2 and a molecular weight of 364.37 g/mol. Its IUPAC name is N'-[5-amino-6-(2-benzoylhydrazinyl)pyrimidin-4-yl]pyridine-3-carbohydrazide.
| Compound Name | N'-[5-amino-6-(2-benzoylhydrazinyl)pyrimidin-4-yl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 19150633 |
| Molecular Formula | C17H16N8O2 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | N'-[5-amino-6-(2-benzoylhydrazinyl)pyrimidin-4-yl]pyridine-3-carbohydrazide |
| SMILES | Nc1c(NNC(=O)c2ccccc2)ncnc1NNC(=O)c1cccnc1 |
| InChI | InChI=1S/C17H16N8O2/c18-13-14(22-24-16(26)11-5-2-1-3-6-11)20-10-21-15(13)23-25-17(27)12-7-4-8-19-9-12/h1-10H,18H2,(H,24,26)(H,25,27)(H2,20,21,22,23) |
| InChIKey | BOBLAYGRPVNIOD-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 146.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|