C11H13N7O — CID 19135090
N'-[5-amino-6-(methylamino)pyrimidin-4-yl]pyridine-3-carbohydrazide (PubChem CID 19135090) has the molecular formula C11H13N7O and a molecular weight of 259.27 g/mol. Its IUPAC name is N'-[5-amino-6-(methylamino)pyrimidin-4-yl]pyridine-3-carbohydrazide.
| Compound Name | N'-[5-amino-6-(methylamino)pyrimidin-4-yl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 19135090 |
| Molecular Formula | C11H13N7O |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | N'-[5-amino-6-(methylamino)pyrimidin-4-yl]pyridine-3-carbohydrazide |
| SMILES | CNc1ncnc(NNC(=O)c2cccnc2)c1N |
| InChI | InChI=1S/C11H13N7O/c1-13-9-8(12)10(16-6-15-9)17-18-11(19)7-3-2-4-14-5-7/h2-6H,12H2,1H3,(H,18,19)(H2,13,15,16,17) |
| InChIKey | NZSBNPMCEDMPMH-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|