C16H14IN7O — CID 19148917
N'-[5-amino-6-(4-iodoanilino)pyrimidin-4-yl]pyridine-3-carbohydrazide (PubChem CID 19148917) has the molecular formula C16H14IN7O and a molecular weight of 447.24 g/mol. Its IUPAC name is N'-[5-amino-6-(4-iodoanilino)pyrimidin-4-yl]pyridine-3-carbohydrazide.
| Compound Name | N'-[5-amino-6-(4-iodoanilino)pyrimidin-4-yl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 19148917 |
| Molecular Formula | C16H14IN7O |
| Molecular Weight | 447.24 g/mol |
| Exact Mass | 447.03 |
| IUPAC Name | N'-[5-amino-6-(4-iodoanilino)pyrimidin-4-yl]pyridine-3-carbohydrazide |
| SMILES | Nc1c(NNC(=O)c2cccnc2)ncnc1Nc1ccc(I)cc1 |
| InChI | InChI=1S/C16H14IN7O/c17-11-3-5-12(6-4-11)22-14-13(18)15(21-9-20-14)23-24-16(25)10-2-1-7-19-8-10/h1-9H,18H2,(H,24,25)(H2,20,21,22,23) |
| InChIKey | OEEVPZNFVGVPSL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.24 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|