C22H19N7O2 — CID 19151939
N'-[5-amino-6-(4-phenoxyanilino)pyrimidin-4-yl]pyridine-3-carbohydrazide (PubChem CID 19151939) has the molecular formula C22H19N7O2 and a molecular weight of 413.44 g/mol. Its IUPAC name is N'-[5-amino-6-(4-phenoxyanilino)pyrimidin-4-yl]pyridine-3-carbohydrazide.
| Compound Name | N'-[5-amino-6-(4-phenoxyanilino)pyrimidin-4-yl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 19151939 |
| Molecular Formula | C22H19N7O2 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | N'-[5-amino-6-(4-phenoxyanilino)pyrimidin-4-yl]pyridine-3-carbohydrazide |
| SMILES | Nc1c(NNC(=O)c2cccnc2)ncnc1Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C22H19N7O2/c23-19-20(25-14-26-21(19)28-29-22(30)15-5-4-12-24-13-15)27-16-8-10-18(11-9-16)31-17-6-2-1-3-7-17/h1-14H,23H2,(H,29,30)(H2,25,26,27,28) |
| InChIKey | BRMPJSKYCLEJJC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 127.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|