C16H14N6O2 — CID 19150656
N'-(5-amino-6-pyridin-3-yloxypyrimidin-4-yl)benzohydrazide (PubChem CID 19150656) has the molecular formula C16H14N6O2 and a molecular weight of 322.33 g/mol. Its IUPAC name is N'-(5-amino-6-pyridin-3-yloxypyrimidin-4-yl)benzohydrazide.
| Compound Name | N'-(5-amino-6-pyridin-3-yloxypyrimidin-4-yl)benzohydrazide |
|---|---|
| PubChem CID | 19150656 |
| Molecular Formula | C16H14N6O2 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | N'-(5-amino-6-pyridin-3-yloxypyrimidin-4-yl)benzohydrazide |
| SMILES | Nc1c(NNC(=O)c2ccccc2)ncnc1Oc1cccnc1 |
| InChI | InChI=1S/C16H14N6O2/c17-13-14(21-22-15(23)11-5-2-1-3-6-11)19-10-20-16(13)24-12-7-4-8-18-9-12/h1-10H,17H2,(H,22,23)(H,19,20,21) |
| InChIKey | ISVRZTYVKIWBRN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|