C11H12N6O — CID 10466983
N'-(5,6-diaminopyrimidin-4-yl)benzohydrazide (PubChem CID 10466983) has the molecular formula C11H12N6O and a molecular weight of 244.26 g/mol. Its IUPAC name is N'-(5,6-diaminopyrimidin-4-yl)benzohydrazide.
| Compound Name | N'-(5,6-diaminopyrimidin-4-yl)benzohydrazide |
|---|---|
| PubChem CID | 10466983 |
| Molecular Formula | C11H12N6O |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | N'-(5,6-diaminopyrimidin-4-yl)benzohydrazide |
| SMILES | Nc1ncnc(NNC(=O)c2ccccc2)c1N |
| InChI | InChI=1S/C11H12N6O/c12-8-9(13)14-6-15-10(8)16-17-11(18)7-4-2-1-3-5-7/h1-6H,12H2,(H,17,18)(H3,13,14,15,16) |
| InChIKey | SKMYRDOIIKVQEI-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|