C12H14N6O — CID 19137179
N'-(5,6-diaminopyrimidin-4-yl)-2-phenylacetohydrazide (PubChem CID 19137179) has the molecular formula C12H14N6O and a molecular weight of 258.29 g/mol. Its IUPAC name is N'-(5,6-diaminopyrimidin-4-yl)-2-phenylacetohydrazide.
| Compound Name | N'-(5,6-diaminopyrimidin-4-yl)-2-phenylacetohydrazide |
|---|---|
| PubChem CID | 19137179 |
| Molecular Formula | C12H14N6O |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | N'-(5,6-diaminopyrimidin-4-yl)-2-phenylacetohydrazide |
| SMILES | Nc1ncnc(NNC(=O)Cc2ccccc2)c1N |
| InChI | InChI=1S/C12H14N6O/c13-10-11(14)15-7-16-12(10)18-17-9(19)6-8-4-2-1-3-5-8/h1-5,7H,6,13H2,(H,17,19)(H3,14,15,16,18) |
| InChIKey | YULWEKCMJSRAQT-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|