C15H15N7OS — CID 19147596
N'-[5-amino-6-(1,3-thiazol-2-ylamino)pyrimidin-4-yl]-2-phenylacetohydrazide (PubChem CID 19147596) has the molecular formula C15H15N7OS and a molecular weight of 341.40 g/mol. Its IUPAC name is N'-[5-amino-6-(1,3-thiazol-2-ylamino)pyrimidin-4-yl]-2-phenylacetohydrazide.
| Compound Name | N'-[5-amino-6-(1,3-thiazol-2-ylamino)pyrimidin-4-yl]-2-phenylacetohydrazide |
|---|---|
| PubChem CID | 19147596 |
| Molecular Formula | C15H15N7OS |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | N'-[5-amino-6-(1,3-thiazol-2-ylamino)pyrimidin-4-yl]-2-phenylacetohydrazide |
| SMILES | Nc1c(NNC(=O)Cc2ccccc2)ncnc1Nc1nccs1 |
| InChI | InChI=1S/C15H15N7OS/c16-12-13(20-15-17-6-7-24-15)18-9-19-14(12)22-21-11(23)8-10-4-2-1-3-5-10/h1-7,9H,8,16H2,(H,21,23)(H2,17,18,19,20,22) |
| InChIKey | NGPXFVQBQKMWEK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|