C17H17N7O3 — CID 19152033
N'-[5-amino-6-[2-(2-phenylacetyl)hydrazinyl]pyrimidin-4-yl]furan-2-carbohydrazide (PubChem CID 19152033) has the molecular formula C17H17N7O3 and a molecular weight of 367.37 g/mol. Its IUPAC name is N'-[5-amino-6-[2-(2-phenylacetyl)hydrazinyl]pyrimidin-4-yl]furan-2-carbohydrazide.
| Compound Name | N'-[5-amino-6-[2-(2-phenylacetyl)hydrazinyl]pyrimidin-4-yl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 19152033 |
| Molecular Formula | C17H17N7O3 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | N'-[5-amino-6-[2-(2-phenylacetyl)hydrazinyl]pyrimidin-4-yl]furan-2-carbohydrazide |
| SMILES | Nc1c(NNC(=O)Cc2ccccc2)ncnc1NNC(=O)c1ccco1 |
| InChI | InChI=1S/C17H17N7O3/c18-14-15(22-21-13(25)9-11-5-2-1-3-6-11)19-10-20-16(14)23-24-17(26)12-7-4-8-27-12/h1-8,10H,9,18H2,(H,21,25)(H,24,26)(H2,19,20,22,23) |
| InChIKey | BBDJFKYMBPFHNK-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 147.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|