C13H18N6O3 — CID 19144226
N'-[5-amino-6-(3-methoxypropylamino)pyrimidin-4-yl]furan-2-carbohydrazide (PubChem CID 19144226) has the molecular formula C13H18N6O3 and a molecular weight of 306.33 g/mol. Its IUPAC name is N'-[5-amino-6-(3-methoxypropylamino)pyrimidin-4-yl]furan-2-carbohydrazide.
| Compound Name | N'-[5-amino-6-(3-methoxypropylamino)pyrimidin-4-yl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 19144226 |
| Molecular Formula | C13H18N6O3 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | N'-[5-amino-6-(3-methoxypropylamino)pyrimidin-4-yl]furan-2-carbohydrazide |
| SMILES | COCCCNc1ncnc(NNC(=O)c2ccco2)c1N |
| InChI | InChI=1S/C13H18N6O3/c1-21-6-3-5-15-11-10(14)12(17-8-16-11)18-19-13(20)9-4-2-7-22-9/h2,4,7-8H,3,5-6,14H2,1H3,(H,19,20)(H2,15,16,17,18) |
| InChIKey | DEVSQAUQLHMMRK-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 127.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|