C14H17BrN6O2 — CID 19150447
N'-[5-amino-6-(2-methoxyethylamino)pyrimidin-4-yl]-4-bromobenzohydrazide (PubChem CID 19150447) has the molecular formula C14H17BrN6O2 and a molecular weight of 381.23 g/mol. Its IUPAC name is N'-[5-amino-6-(2-methoxyethylamino)pyrimidin-4-yl]-4-bromobenzohydrazide.
| Compound Name | N'-[5-amino-6-(2-methoxyethylamino)pyrimidin-4-yl]-4-bromobenzohydrazide |
|---|---|
| PubChem CID | 19150447 |
| Molecular Formula | C14H17BrN6O2 |
| Molecular Weight | 381.23 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | N'-[5-amino-6-(2-methoxyethylamino)pyrimidin-4-yl]-4-bromobenzohydrazide |
| SMILES | COCCNc1ncnc(NNC(=O)c2ccc(Br)cc2)c1N |
| InChI | InChI=1S/C14H17BrN6O2/c1-23-7-6-17-12-11(16)13(19-8-18-12)20-21-14(22)9-2-4-10(15)5-3-9/h2-5,8H,6-7,16H2,1H3,(H,21,22)(H2,17,18,19,20) |
| InChIKey | WOKJRKUTJODMEV-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|