C25H23BrN6O — CID 19136425
N'-[5-amino-6-(dibenzylamino)pyrimidin-4-yl]-4-bromobenzohydrazide (PubChem CID 19136425) has the molecular formula C25H23BrN6O and a molecular weight of 503.40 g/mol. Its IUPAC name is N'-[5-amino-6-(dibenzylamino)pyrimidin-4-yl]-4-bromobenzohydrazide.
| Compound Name | N'-[5-amino-6-(dibenzylamino)pyrimidin-4-yl]-4-bromobenzohydrazide |
|---|---|
| PubChem CID | 19136425 |
| Molecular Formula | C25H23BrN6O |
| Molecular Weight | 503.40 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | N'-[5-amino-6-(dibenzylamino)pyrimidin-4-yl]-4-bromobenzohydrazide |
| SMILES | Nc1c(NNC(=O)c2ccc(Br)cc2)ncnc1N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H23BrN6O/c26-21-13-11-20(12-14-21)25(33)31-30-23-22(27)24(29-17-28-23)32(15-18-7-3-1-4-8-18)16-19-9-5-2-6-10-19/h1-14,17H,15-16,27H2,(H,31,33)(H,28,29,30) |
| InChIKey | CCCRVPJVWNEBOL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.40 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|