C24H23N7O2 — CID 19151774
N'-[5-amino-6-[benzyl(pyridin-2-yl)amino]pyrimidin-4-yl]-4-methoxybenzohydrazide (PubChem CID 19151774) has the molecular formula C24H23N7O2 and a molecular weight of 441.50 g/mol. Its IUPAC name is N'-[5-amino-6-[benzyl(pyridin-2-yl)amino]pyrimidin-4-yl]-4-methoxybenzohydrazide.
| Compound Name | N'-[5-amino-6-[benzyl(pyridin-2-yl)amino]pyrimidin-4-yl]-4-methoxybenzohydrazide |
|---|---|
| PubChem CID | 19151774 |
| Molecular Formula | C24H23N7O2 |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | N'-[5-amino-6-[benzyl(pyridin-2-yl)amino]pyrimidin-4-yl]-4-methoxybenzohydrazide |
| SMILES | COc1ccc(C(=O)NNc2ncnc(N(Cc3ccccc3)c3ccccn3)c2N)cc1 |
| InChI | InChI=1S/C24H23N7O2/c1-33-19-12-10-18(11-13-19)24(32)30-29-22-21(25)23(28-16-27-22)31(20-9-5-6-14-26-20)15-17-7-3-2-4-8-17/h2-14,16H,15,25H2,1H3,(H,30,32)(H,27,28,29) |
| InChIKey | WKBFHPGVDCGBKK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 118.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|