C19H19N5O4 — CID 19151807
N'-[5-amino-6-(4-methoxyphenoxy)pyrimidin-4-yl]-4-methoxybenzohydrazide (PubChem CID 19151807) has the molecular formula C19H19N5O4 and a molecular weight of 381.39 g/mol. Its IUPAC name is N'-[5-amino-6-(4-methoxyphenoxy)pyrimidin-4-yl]-4-methoxybenzohydrazide.
| Compound Name | N'-[5-amino-6-(4-methoxyphenoxy)pyrimidin-4-yl]-4-methoxybenzohydrazide |
|---|---|
| PubChem CID | 19151807 |
| Molecular Formula | C19H19N5O4 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | N'-[5-amino-6-(4-methoxyphenoxy)pyrimidin-4-yl]-4-methoxybenzohydrazide |
| SMILES | COc1ccc(Oc2ncnc(NNC(=O)c3ccc(OC)cc3)c2N)cc1 |
| InChI | InChI=1S/C19H19N5O4/c1-26-13-5-3-12(4-6-13)18(25)24-23-17-16(20)19(22-11-21-17)28-15-9-7-14(27-2)8-10-15/h3-11H,20H2,1-2H3,(H,24,25)(H,21,22,23) |
| InChIKey | UMNYRLZUUAINDR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 120.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|