C12H15N7O2 — CID 19150367
N'-(5-amino-6-hydrazinylpyrimidin-4-yl)-4-methoxybenzohydrazide (PubChem CID 19150367) has the molecular formula C12H15N7O2 and a molecular weight of 289.30 g/mol. Its IUPAC name is N'-(5-amino-6-hydrazinylpyrimidin-4-yl)-4-methoxybenzohydrazide.
| Compound Name | N'-(5-amino-6-hydrazinylpyrimidin-4-yl)-4-methoxybenzohydrazide |
|---|---|
| PubChem CID | 19150367 |
| Molecular Formula | C12H15N7O2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N'-(5-amino-6-hydrazinylpyrimidin-4-yl)-4-methoxybenzohydrazide |
| SMILES | COc1ccc(C(=O)NNc2ncnc(NN)c2N)cc1 |
| InChI | InChI=1S/C12H15N7O2/c1-21-8-4-2-7(3-5-8)12(20)19-18-11-9(13)10(17-14)15-6-16-11/h2-6H,13-14H2,1H3,(H,19,20)(H2,15,16,17,18) |
| InChIKey | XPCZOINZDZKEON-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 140.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|