C30H27N7O — CID 19152191
N'-[5-amino-6-[benzyl(pyridin-2-yl)amino]pyrimidin-4-yl]-2,2-diphenylacetohydrazide (PubChem CID 19152191) has the molecular formula C30H27N7O and a molecular weight of 501.59 g/mol. Its IUPAC name is N'-[5-amino-6-[benzyl(pyridin-2-yl)amino]pyrimidin-4-yl]-2,2-diphenylacetohydrazide.
| Compound Name | N'-[5-amino-6-[benzyl(pyridin-2-yl)amino]pyrimidin-4-yl]-2,2-diphenylacetohydrazide |
|---|---|
| PubChem CID | 19152191 |
| Molecular Formula | C30H27N7O |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | N'-[5-amino-6-[benzyl(pyridin-2-yl)amino]pyrimidin-4-yl]-2,2-diphenylacetohydrazide |
| SMILES | Nc1c(NNC(=O)C(c2ccccc2)c2ccccc2)ncnc1N(Cc1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C30H27N7O/c31-27-28(35-36-30(38)26(23-14-6-2-7-15-23)24-16-8-3-9-17-24)33-21-34-29(27)37(25-18-10-11-19-32-25)20-22-12-4-1-5-13-22/h1-19,21,26H,20,31H2,(H,36,38)(H,33,34,35) |
| InChIKey | DAQCXOHQSSDQFU-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 109.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|