C26H26N6O — CID 22539870
N'-[5-amino-6-(N-ethylanilino)pyrimidin-4-yl]-2,2-diphenylacetohydrazide (PubChem CID 22539870) has the molecular formula C26H26N6O and a molecular weight of 438.54 g/mol. Its IUPAC name is N'-[5-amino-6-(N-ethylanilino)pyrimidin-4-yl]-2,2-diphenylacetohydrazide.
| Compound Name | N'-[5-amino-6-(N-ethylanilino)pyrimidin-4-yl]-2,2-diphenylacetohydrazide |
|---|---|
| PubChem CID | 22539870 |
| Molecular Formula | C26H26N6O |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | N'-[5-amino-6-(N-ethylanilino)pyrimidin-4-yl]-2,2-diphenylacetohydrazide |
| SMILES | CCN(c1ccccc1)c1ncnc(NNC(=O)C(c2ccccc2)c2ccccc2)c1N |
| InChI | InChI=1S/C26H26N6O/c1-2-32(21-16-10-5-11-17-21)25-23(27)24(28-18-29-25)30-31-26(33)22(19-12-6-3-7-13-19)20-14-8-4-9-15-20/h3-18,22H,2,27H2,1H3,(H,31,33)(H,28,29,30) |
| InChIKey | WOKQCRBIRNGXNR-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|