C24H21FN6O — CID 19145201
N'-[5-amino-6-(2-fluoroanilino)pyrimidin-4-yl]-2,2-diphenylacetohydrazide (PubChem CID 19145201) has the molecular formula C24H21FN6O and a molecular weight of 428.47 g/mol. Its IUPAC name is N'-[5-amino-6-(2-fluoroanilino)pyrimidin-4-yl]-2,2-diphenylacetohydrazide.
| Compound Name | N'-[5-amino-6-(2-fluoroanilino)pyrimidin-4-yl]-2,2-diphenylacetohydrazide |
|---|---|
| PubChem CID | 19145201 |
| Molecular Formula | C24H21FN6O |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | N'-[5-amino-6-(2-fluoroanilino)pyrimidin-4-yl]-2,2-diphenylacetohydrazide |
| SMILES | Nc1c(NNC(=O)C(c2ccccc2)c2ccccc2)ncnc1Nc1ccccc1F |
| InChI | InChI=1S/C24H21FN6O/c25-18-13-7-8-14-19(18)29-22-21(26)23(28-15-27-22)30-31-24(32)20(16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-15,20H,26H2,(H,31,32)(H2,27,28,29,30) |
| InChIKey | LUKJWANROVLYCF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|