C22H24N6O — CID 19137361
N'-(5-amino-6-pyrrolidin-1-ylpyrimidin-4-yl)-2,2-diphenylacetohydrazide (PubChem CID 19137361) has the molecular formula C22H24N6O and a molecular weight of 388.48 g/mol. Its IUPAC name is N'-(5-amino-6-pyrrolidin-1-ylpyrimidin-4-yl)-2,2-diphenylacetohydrazide.
| Compound Name | N'-(5-amino-6-pyrrolidin-1-ylpyrimidin-4-yl)-2,2-diphenylacetohydrazide |
|---|---|
| PubChem CID | 19137361 |
| Molecular Formula | C22H24N6O |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | N'-(5-amino-6-pyrrolidin-1-ylpyrimidin-4-yl)-2,2-diphenylacetohydrazide |
| SMILES | Nc1c(NNC(=O)C(c2ccccc2)c2ccccc2)ncnc1N1CCCC1 |
| InChI | InChI=1S/C22H24N6O/c23-19-20(24-15-25-21(19)28-13-7-8-14-28)26-27-22(29)18(16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-6,9-12,15,18H,7-8,13-14,23H2,(H,27,29)(H,24,25,26) |
| InChIKey | QOKUQSKTVJKXNB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|