C24H28N6O — CID 19137910
N'-[5-amino-6-(azepan-1-yl)pyrimidin-4-yl]-2,2-diphenylacetohydrazide (PubChem CID 19137910) has the molecular formula C24H28N6O and a molecular weight of 416.53 g/mol. Its IUPAC name is N'-[5-amino-6-(azepan-1-yl)pyrimidin-4-yl]-2,2-diphenylacetohydrazide.
| Compound Name | N'-[5-amino-6-(azepan-1-yl)pyrimidin-4-yl]-2,2-diphenylacetohydrazide |
|---|---|
| PubChem CID | 19137910 |
| Molecular Formula | C24H28N6O |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | N'-[5-amino-6-(azepan-1-yl)pyrimidin-4-yl]-2,2-diphenylacetohydrazide |
| SMILES | Nc1c(NNC(=O)C(c2ccccc2)c2ccccc2)ncnc1N1CCCCCC1 |
| InChI | InChI=1S/C24H28N6O/c25-21-22(26-17-27-23(21)30-15-9-1-2-10-16-30)28-29-24(31)20(18-11-5-3-6-12-18)19-13-7-4-8-14-19/h3-8,11-14,17,20H,1-2,9-10,15-16,25H2,(H,29,31)(H,26,27,28) |
| InChIKey | ZZFQKJDCKFQPCD-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|