C30H33N7O — CID 19152192
N'-[5-amino-6-[4-(2,3-dimethylphenyl)piperazin-1-yl]pyrimidin-4-yl]-2,2-diphenylacetohydrazide (PubChem CID 19152192) has the molecular formula C30H33N7O and a molecular weight of 507.64 g/mol. Its IUPAC name is N'-[5-amino-6-[4-(2,3-dimethylphenyl)piperazin-1-yl]pyrimidin-4-yl]-2,2-diphenylacetohydrazide.
| Compound Name | N'-[5-amino-6-[4-(2,3-dimethylphenyl)piperazin-1-yl]pyrimidin-4-yl]-2,2-diphenylacetohydrazide |
|---|---|
| PubChem CID | 19152192 |
| Molecular Formula | C30H33N7O |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | N'-[5-amino-6-[4-(2,3-dimethylphenyl)piperazin-1-yl]pyrimidin-4-yl]-2,2-diphenylacetohydrazide |
| SMILES | Cc1cccc(N2CCN(c3ncnc(NNC(=O)C(c4ccccc4)c4ccccc4)c3N)CC2)c1C |
| InChI | InChI=1S/C30H33N7O/c1-21-10-9-15-25(22(21)2)36-16-18-37(19-17-36)29-27(31)28(32-20-33-29)34-35-30(38)26(23-11-5-3-6-12-23)24-13-7-4-8-14-24/h3-15,20,26H,16-19,31H2,1-2H3,(H,35,38)(H,32,33,34) |
| InChIKey | HUKNGRANCVWJGX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|