C23H26BrN7O — CID 19151082
N'-[5-amino-6-[4-(2,3-dimethylphenyl)piperazin-1-yl]pyrimidin-4-yl]-4-bromobenzohydrazide (PubChem CID 19151082) has the molecular formula C23H26BrN7O and a molecular weight of 496.41 g/mol. Its IUPAC name is N'-[5-amino-6-[4-(2,3-dimethylphenyl)piperazin-1-yl]pyrimidin-4-yl]-4-bromobenzohydrazide.
| Compound Name | N'-[5-amino-6-[4-(2,3-dimethylphenyl)piperazin-1-yl]pyrimidin-4-yl]-4-bromobenzohydrazide |
|---|---|
| PubChem CID | 19151082 |
| Molecular Formula | C23H26BrN7O |
| Molecular Weight | 496.41 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | N'-[5-amino-6-[4-(2,3-dimethylphenyl)piperazin-1-yl]pyrimidin-4-yl]-4-bromobenzohydrazide |
| SMILES | Cc1cccc(N2CCN(c3ncnc(NNC(=O)c4ccc(Br)cc4)c3N)CC2)c1C |
| InChI | InChI=1S/C23H26BrN7O/c1-15-4-3-5-19(16(15)2)30-10-12-31(13-11-30)22-20(25)21(26-14-27-22)28-29-23(32)17-6-8-18(24)9-7-17/h3-9,14H,10-13,25H2,1-2H3,(H,29,32)(H,26,27,28) |
| InChIKey | VSEQFUWGRBYPDS-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|