C23H24FN7O3 — CID 22535562
N'-[6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-4-fluorobenzohydrazide (PubChem CID 22535562) has the molecular formula C23H24FN7O3 and a molecular weight of 465.49 g/mol. Its IUPAC name is N'-[6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-4-fluorobenzohydrazide.
| Compound Name | N'-[6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 22535562 |
| Molecular Formula | C23H24FN7O3 |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | N'-[6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]-4-fluorobenzohydrazide |
| SMILES | Cc1cccc(N2CCN(c3ncnc(NNC(=O)c4ccc(F)cc4)c3[N+](=O)[O-])CC2)c1C |
| InChI | InChI=1S/C23H24FN7O3/c1-15-4-3-5-19(16(15)2)29-10-12-30(13-11-29)22-20(31(33)34)21(25-14-26-22)27-28-23(32)17-6-8-18(24)9-7-17/h3-9,14H,10-13H2,1-2H3,(H,28,32)(H,25,26,27) |
| InChIKey | FCMKZJAKQHTXES-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|