C24H28N6O2 — CID 22534661
6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-[(4-methylphenyl)methyl]-5-nitropyrimidin-4-amine (PubChem CID 22534661) has the molecular formula C24H28N6O2 and a molecular weight of 432.53 g/mol. Its IUPAC name is 6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-[(4-methylphenyl)methyl]-5-nitropyrimidin-4-amine.
| Compound Name | 6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-[(4-methylphenyl)methyl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 22534661 |
| Molecular Formula | C24H28N6O2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-[(4-methylphenyl)methyl]-5-nitropyrimidin-4-amine |
| SMILES | Cc1ccc(CNc2ncnc(N3CCN(c4cccc(C)c4C)CC3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H28N6O2/c1-17-7-9-20(10-8-17)15-25-23-22(30(31)32)24(27-16-26-23)29-13-11-28(12-14-29)21-6-4-5-18(2)19(21)3/h4-10,16H,11-15H2,1-3H3,(H,25,26,27) |
| InChIKey | NIFKWUORVQHUOQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 87.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|