C23H24N6O4 — CID 22538362
4-[[6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]amino]benzoic acid (PubChem CID 22538362) has the molecular formula C23H24N6O4 and a molecular weight of 448.48 g/mol. Its IUPAC name is 4-[[6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 4-[[6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 22538362 |
| Molecular Formula | C23H24N6O4 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 4-[[6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]amino]benzoic acid |
| SMILES | Cc1cccc(N2CCN(c3ncnc(Nc4ccc(C(=O)O)cc4)c3[N+](=O)[O-])CC2)c1C |
| InChI | InChI=1S/C23H24N6O4/c1-15-4-3-5-19(16(15)2)27-10-12-28(13-11-27)22-20(29(32)33)21(24-14-25-22)26-18-8-6-17(7-9-18)23(30)31/h3-9,14H,10-13H2,1-2H3,(H,30,31)(H,24,25,26) |
| InChIKey | DXAQJFHDBGLBDA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 124.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|