C22H25N7O2 — CID 23483860
6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-(4-methyl-2-pyridinyl)-5-nitropyrimidin-4-amine (PubChem CID 23483860) has the molecular formula C22H25N7O2 and a molecular weight of 419.49 g/mol. Its IUPAC name is 6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-(4-methyl-2-pyridinyl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-(4-methyl-2-pyridinyl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23483860 |
| Molecular Formula | C22H25N7O2 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-(4-methyl-2-pyridinyl)-5-nitropyrimidin-4-amine |
| SMILES | Cc1ccnc(Nc2ncnc(N3CCN(c4cccc(C)c4C)CC3)c2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H25N7O2/c1-15-7-8-23-19(13-15)26-21-20(29(30)31)22(25-14-24-21)28-11-9-27(10-12-28)18-6-4-5-16(2)17(18)3/h4-8,13-14H,9-12H2,1-3H3,(H,23,24,25,26) |
| InChIKey | VQUSKTQJUPJDKN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 100.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|