C22H22ClN5O2S — CID 23488609
4-(4-chlorophenyl)sulfanyl-6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-5-nitropyrimidine (PubChem CID 23488609) has the molecular formula C22H22ClN5O2S and a molecular weight of 455.97 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-5-nitropyrimidine.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-5-nitropyrimidine |
|---|---|
| PubChem CID | 23488609 |
| Molecular Formula | C22H22ClN5O2S |
| Molecular Weight | 455.97 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-6-[4-(2,3-dimethylphenyl)piperazin-1-yl]-5-nitropyrimidine |
| SMILES | Cc1cccc(N2CCN(c3ncnc(Sc4ccc(Cl)cc4)c3[N+](=O)[O-])CC2)c1C |
| InChI | InChI=1S/C22H22ClN5O2S/c1-15-4-3-5-19(16(15)2)26-10-12-27(13-11-26)21-20(28(29)30)22(25-14-24-21)31-18-8-6-17(23)7-9-18/h3-9,14H,10-13H2,1-2H3 |
| InChIKey | LFYKSLRTXGMZLS-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 75.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.97 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|