C19H16N4O2S — CID 23481791
1-[6-(4-methylphenyl)sulfanyl-5-nitropyrimidin-4-yl]-2,3-dihydroindole (PubChem CID 23481791) has the molecular formula C19H16N4O2S and a molecular weight of 364.43 g/mol. Its IUPAC name is 1-[6-(4-methylphenyl)sulfanyl-5-nitropyrimidin-4-yl]-2,3-dihydroindole.
| Compound Name | 1-[6-(4-methylphenyl)sulfanyl-5-nitropyrimidin-4-yl]-2,3-dihydroindole |
|---|---|
| PubChem CID | 23481791 |
| Molecular Formula | C19H16N4O2S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 1-[6-(4-methylphenyl)sulfanyl-5-nitropyrimidin-4-yl]-2,3-dihydroindole |
| SMILES | Cc1ccc(Sc2ncnc(N3CCc4ccccc43)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H16N4O2S/c1-13-6-8-15(9-7-13)26-19-17(23(24)25)18(20-12-21-19)22-11-10-14-4-2-3-5-16(14)22/h2-9,12H,10-11H2,1H3 |
| InChIKey | QQXQRWMLMRGBSL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 72.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|