C21H26N4O2S — CID 23492824
1,3,3-trimethyl-6-[6-(4-methylphenyl)sulfanyl-5-nitropyrimidin-4-yl]-6-azabicyclo[3.2.1]octane (PubChem CID 23492824) has the molecular formula C21H26N4O2S and a molecular weight of 398.53 g/mol. Its IUPAC name is 1,3,3-trimethyl-6-[6-(4-methylphenyl)sulfanyl-5-nitropyrimidin-4-yl]-6-azabicyclo[3.2.1]octane.
| Compound Name | 1,3,3-trimethyl-6-[6-(4-methylphenyl)sulfanyl-5-nitropyrimidin-4-yl]-6-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 23492824 |
| Molecular Formula | C21H26N4O2S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 1,3,3-trimethyl-6-[6-(4-methylphenyl)sulfanyl-5-nitropyrimidin-4-yl]-6-azabicyclo[3.2.1]octane |
| SMILES | Cc1ccc(Sc2ncnc(N3CC4(C)CC3CC(C)(C)C4)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H26N4O2S/c1-14-5-7-16(8-6-14)28-19-17(25(26)27)18(22-13-23-19)24-12-21(4)10-15(24)9-20(2,3)11-21/h5-8,13,15H,9-12H2,1-4H3 |
| InChIKey | LPRULCZRAWCXEK-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 72.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|