C19H24N6O4 — CID 23492854
N'-[5-nitro-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-yl]furan-2-carbohydrazide (PubChem CID 23492854) has the molecular formula C19H24N6O4 and a molecular weight of 400.44 g/mol. Its IUPAC name is N'-[5-nitro-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-yl]furan-2-carbohydrazide.
| Compound Name | N'-[5-nitro-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-yl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 23492854 |
| Molecular Formula | C19H24N6O4 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | N'-[5-nitro-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-yl]furan-2-carbohydrazide |
| SMILES | CC1(C)CC2CC(C)(CN2c2ncnc(NNC(=O)c3ccco3)c2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C19H24N6O4/c1-18(2)7-12-8-19(3,9-18)10-24(12)16-14(25(27)28)15(20-11-21-16)22-23-17(26)13-5-4-6-29-13/h4-6,11-12H,7-10H2,1-3H3,(H,23,26)(H,20,21,22) |
| InChIKey | HTWMLXORRKMTJF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|