C19H18FN7O4 — CID 22536790
N'-[6-[4-(4-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]furan-2-carbohydrazide (PubChem CID 22536790) has the molecular formula C19H18FN7O4 and a molecular weight of 427.40 g/mol. Its IUPAC name is N'-[6-[4-(4-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]furan-2-carbohydrazide.
| Compound Name | N'-[6-[4-(4-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 22536790 |
| Molecular Formula | C19H18FN7O4 |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | N'-[6-[4-(4-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]furan-2-carbohydrazide |
| SMILES | O=C(NNc1ncnc(N2CCN(c3ccc(F)cc3)CC2)c1[N+](=O)[O-])c1ccco1 |
| InChI | InChI=1S/C19H18FN7O4/c20-13-3-5-14(6-4-13)25-7-9-26(10-8-25)18-16(27(29)30)17(21-12-22-18)23-24-19(28)15-2-1-11-31-15/h1-6,11-12H,7-10H2,(H,24,28)(H,21,22,23) |
| InChIKey | ODYZZUCAEVSEQL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 129.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|