C20H18BrFN6O2 — CID 22532219
N-(2-bromophenyl)-6-[4-(4-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine (PubChem CID 22532219) has the molecular formula C20H18BrFN6O2 and a molecular weight of 473.31 g/mol. Its IUPAC name is N-(2-bromophenyl)-6-[4-(4-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine.
| Compound Name | N-(2-bromophenyl)-6-[4-(4-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 22532219 |
| Molecular Formula | C20H18BrFN6O2 |
| Molecular Weight | 473.31 g/mol |
| Exact Mass | 472.07 |
| IUPAC Name | N-(2-bromophenyl)-6-[4-(4-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(Nc2ccccc2Br)ncnc1N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H18BrFN6O2/c21-16-3-1-2-4-17(16)25-19-18(28(29)30)20(24-13-23-19)27-11-9-26(10-12-27)15-7-5-14(22)6-8-15/h1-8,13H,9-12H2,(H,23,24,25) |
| InChIKey | XSKSQQYFJOMGHH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 87.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.31 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|