C21H19F3N6O2 — CID 23484152
5-nitro-6-(4-phenylpiperazin-1-yl)-N-[2-(trifluoromethyl)phenyl]pyrimidin-4-amine (PubChem CID 23484152) has the molecular formula C21H19F3N6O2 and a molecular weight of 444.42 g/mol. Its IUPAC name is 5-nitro-6-(4-phenylpiperazin-1-yl)-N-[2-(trifluoromethyl)phenyl]pyrimidin-4-amine.
| Compound Name | 5-nitro-6-(4-phenylpiperazin-1-yl)-N-[2-(trifluoromethyl)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 23484152 |
| Molecular Formula | C21H19F3N6O2 |
| Molecular Weight | 444.42 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 5-nitro-6-(4-phenylpiperazin-1-yl)-N-[2-(trifluoromethyl)phenyl]pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(Nc2ccccc2C(F)(F)F)ncnc1N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H19F3N6O2/c22-21(23,24)16-8-4-5-9-17(16)27-19-18(30(31)32)20(26-14-25-19)29-12-10-28(11-13-29)15-6-2-1-3-7-15/h1-9,14H,10-13H2,(H,25,26,27) |
| InChIKey | AIVKDRUSAMLUAM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 87.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|