C24H27N7O2 — CID 23490429
5-nitro-4,6-bis(4-phenylpiperazin-1-yl)pyrimidine (PubChem CID 23490429) has the molecular formula C24H27N7O2 and a molecular weight of 445.53 g/mol. Its IUPAC name is 5-nitro-4,6-bis(4-phenylpiperazin-1-yl)pyrimidine.
| Compound Name | 5-nitro-4,6-bis(4-phenylpiperazin-1-yl)pyrimidine |
|---|---|
| PubChem CID | 23490429 |
| Molecular Formula | C24H27N7O2 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | 5-nitro-4,6-bis(4-phenylpiperazin-1-yl)pyrimidine |
| SMILES | O=[N+]([O-])c1c(N2CCN(c3ccccc3)CC2)ncnc1N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H27N7O2/c32-31(33)22-23(29-15-11-27(12-16-29)20-7-3-1-4-8-20)25-19-26-24(22)30-17-13-28(14-18-30)21-9-5-2-6-10-21/h1-10,19H,11-18H2 |
| InChIKey | MAKCSZJBNCYVPN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 81.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|