C20H21N7O2 — CID 23490569
N-(5-methyl-2-pyridinyl)-5-nitro-6-(4-phenylpiperazin-1-yl)pyrimidin-4-amine (PubChem CID 23490569) has the molecular formula C20H21N7O2 and a molecular weight of 391.44 g/mol. Its IUPAC name is N-(5-methyl-2-pyridinyl)-5-nitro-6-(4-phenylpiperazin-1-yl)pyrimidin-4-amine.
| Compound Name | N-(5-methyl-2-pyridinyl)-5-nitro-6-(4-phenylpiperazin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 23490569 |
| Molecular Formula | C20H21N7O2 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | N-(5-methyl-2-pyridinyl)-5-nitro-6-(4-phenylpiperazin-1-yl)pyrimidin-4-amine |
| SMILES | Cc1ccc(Nc2ncnc(N3CCN(c4ccccc4)CC3)c2[N+](=O)[O-])nc1 |
| InChI | InChI=1S/C20H21N7O2/c1-15-7-8-17(21-13-15)24-19-18(27(28)29)20(23-14-22-19)26-11-9-25(10-12-26)16-5-3-2-4-6-16/h2-8,13-14H,9-12H2,1H3,(H,21,22,23,24) |
| InChIKey | MROTZZRNAYAQMS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 100.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|