C20H23FN6O4 — CID 22538510
1-[6-[4-(4-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]piperidine-4-carboxylic acid (PubChem CID 22538510) has the molecular formula C20H23FN6O4 and a molecular weight of 430.44 g/mol. Its IUPAC name is 1-[6-[4-(4-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]piperidine-4-carboxylic acid.
| Compound Name | 1-[6-[4-(4-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 22538510 |
| Molecular Formula | C20H23FN6O4 |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 1-[6-[4-(4-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-yl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(c2ncnc(N3CCN(c4ccc(F)cc4)CC3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C20H23FN6O4/c21-15-1-3-16(4-2-15)24-9-11-26(12-10-24)19-17(27(30)31)18(22-13-23-19)25-7-5-14(6-8-25)20(28)29/h1-4,13-14H,5-12H2,(H,28,29) |
| InChIKey | BZXULBKDKJIFJT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 115.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|