C24H29FN6O2 — CID 22525822
N-(1-adamantyl)-6-[4-(4-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine (PubChem CID 22525822) has the molecular formula C24H29FN6O2 and a molecular weight of 452.53 g/mol. Its IUPAC name is N-(1-adamantyl)-6-[4-(4-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine.
| Compound Name | N-(1-adamantyl)-6-[4-(4-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 22525822 |
| Molecular Formula | C24H29FN6O2 |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | N-(1-adamantyl)-6-[4-(4-fluorophenyl)piperazin-1-yl]-5-nitropyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(NC23CC4CC(CC(C4)C2)C3)ncnc1N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H29FN6O2/c25-19-1-3-20(4-2-19)29-5-7-30(8-6-29)23-21(31(32)33)22(26-15-27-23)28-24-12-16-9-17(13-24)11-18(10-16)14-24/h1-4,15-18H,5-14H2,(H,26,27,28) |
| InChIKey | LGNONJFVJPWWPY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 87.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|