C20H21FN6O2S — CID 22538518
6-[4-(4-fluorophenyl)piperazin-1-yl]-5-nitro-N-(2-thiophen-2-ylethyl)pyrimidin-4-amine (PubChem CID 22538518) has the molecular formula C20H21FN6O2S and a molecular weight of 428.49 g/mol. Its IUPAC name is 6-[4-(4-fluorophenyl)piperazin-1-yl]-5-nitro-N-(2-thiophen-2-ylethyl)pyrimidin-4-amine.
| Compound Name | 6-[4-(4-fluorophenyl)piperazin-1-yl]-5-nitro-N-(2-thiophen-2-ylethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 22538518 |
| Molecular Formula | C20H21FN6O2S |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 6-[4-(4-fluorophenyl)piperazin-1-yl]-5-nitro-N-(2-thiophen-2-ylethyl)pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(NCCc2cccs2)ncnc1N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H21FN6O2S/c21-15-3-5-16(6-4-15)25-9-11-26(12-10-25)20-18(27(28)29)19(23-14-24-20)22-8-7-17-2-1-13-30-17/h1-6,13-14H,7-12H2,(H,22,23,24) |
| InChIKey | MBWCCUQVRBCABT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 87.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|