C20H27N7O3 — CID 23490582
N-(2-morpholin-4-ylethyl)-5-nitro-6-(4-phenylpiperazin-1-yl)pyrimidin-4-amine (PubChem CID 23490582) has the molecular formula C20H27N7O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)-5-nitro-6-(4-phenylpiperazin-1-yl)pyrimidin-4-amine.
| Compound Name | N-(2-morpholin-4-ylethyl)-5-nitro-6-(4-phenylpiperazin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 23490582 |
| Molecular Formula | C20H27N7O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)-5-nitro-6-(4-phenylpiperazin-1-yl)pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(NCCN2CCOCC2)ncnc1N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H27N7O3/c28-27(29)18-19(21-6-7-24-12-14-30-15-13-24)22-16-23-20(18)26-10-8-25(9-11-26)17-4-2-1-3-5-17/h1-5,16H,6-15H2,(H,21,22,23) |
| InChIKey | AHSWXRGNIRKOMM-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 99.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|