C20H28N8O2 — CID 22526127
5-nitro-N-(2-piperidin-1-ylethyl)-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine (PubChem CID 22526127) has the molecular formula C20H28N8O2 and a molecular weight of 412.50 g/mol. Its IUPAC name is 5-nitro-N-(2-piperidin-1-ylethyl)-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine.
| Compound Name | 5-nitro-N-(2-piperidin-1-ylethyl)-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 22526127 |
| Molecular Formula | C20H28N8O2 |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 5-nitro-N-(2-piperidin-1-ylethyl)-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(NCCN2CCCCC2)ncnc1N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C20H28N8O2/c29-28(30)18-19(22-8-11-25-9-4-1-5-10-25)23-16-24-20(18)27-14-12-26(13-15-27)17-6-2-3-7-21-17/h2-3,6-7,16H,1,4-5,8-15H2,(H,22,23,24) |
| InChIKey | CFWCLGGHTREKAZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 103.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|